CAS 3414-94-6 appears in our catalog under these names: 5-Phenyl-4h-1,2,4-triazole-3-thiol, 98%, 3-Phenyl-1,2,4-triazole-5-thiol/ 98%, 3-Phenyl-1,2,4-triazole-5-thiol hydrate, 98% , 5-Phenyl-1H-1,2,4-triazole-3-thiol 98%, 5-Phenyl-1H-1,2,4-triazole-3-thiol, 98%, 98%. Offered by: Combi-blocks, Chemat, Thermo Scientific (Alfa Aesar), Ambeed, Fluorochem. Available pack sizes: 5g, 100g, 25g, 1g, 250mg, 10g.
5-phenyl-1,2-dihydro-1,2,4-triazole-3-thione (CAS 3414-94-6) is a chemical compound with the molecular formula C8H7N3S and a molecular weight of 177.23 g/mol. IUPAC name: 5-phenyl-1,2-dihydro-1,2,4-triazole-3-thione. InChIKey: JRLMMJNORORYPO-UHFFFAOYSA-N.
| Molecular formula | C8H7N3S |
|---|---|
| Molecular weight | 177.23 g/mol |
| IUPAC name | 5-phenyl-1,2-dihydro-1,2,4-triazole-3-thione |
| InChIKey | JRLMMJNORORYPO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=S)NN2 |
Computed by PubChem (NCBI)