cas: 105537-97-1 — see every product listed under this CAS number, including other names
5-Phenylpyridazin-3-amine 96% (CAS 105537-97-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A763783-100mg |
| cas | 105537-97-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 587.31 Pln | |
| Ambeed | 250mg | 1176.94 Pln | |
| Ambeed | 1g | 3079.31 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A763783 |
5-phenylpyridazin-3-amine (CAS 105537-97-1) is a chemical compound with the molecular formula C10H9N3 and a molecular weight of 171.20 g/mol. IUPAC name: 5-phenylpyridazin-3-amine. InChIKey: MORAVCUWJRVGHR-UHFFFAOYSA-N.
| Molecular formula | C10H9N3 |
|---|---|
| Molecular weight | 171.20 g/mol |
| IUPAC name | 5-phenylpyridazin-3-amine |
| InChIKey | MORAVCUWJRVGHR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NN=C2)N |
Computed by PubChem (NCBI)