cas: 31408-23-8 — see every product listed under this CAS number, including other names
5-Phenylpyrimidin-2-amine, 97% (CAS 31408-23-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F693095-5G |
| cas | 31408-23-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 2528.29 Pln | |
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 758.08 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5-phenylpyrimidin-2-amine (CAS 31408-23-8) is a chemical compound with the molecular formula C10H9N3 and a molecular weight of 171.20 g/mol. IUPAC name: 5-phenylpyrimidin-2-amine. InChIKey: JYGOFGJNWGAPAN-UHFFFAOYSA-N.
| Molecular formula | C10H9N3 |
|---|---|
| Molecular weight | 171.20 g/mol |
| IUPAC name | 5-phenylpyrimidin-2-amine |
| InChIKey | JYGOFGJNWGAPAN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(N=C2)N |
Computed by PubChem (NCBI)