5-Phenylpyrimidin-2-amine, 97%
cas: 31408-23-8 — see every product listed under this CAS number, including other names
5-Phenylpyrimidin-2-amine, 97% (CAS 31408-23-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A474301-250mg |
| cas | 31408-23-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 615.13 Pln | |
| Ambeed | 5g | 1994.62 Pln | |
| BLDpharm | 100mg | 153.30 Pln | |
| BLDpharm | 250mg | 275.48 Pln | |
| BLDpharm | 1g | 658.68 Pln | |
| BLDpharm | 5g | 2147.05 Pln | |
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 554.00 Pln | |
| Fluorochem | 100mg | 143.72 Pln | |
| Fluorochem | 250mg | 258.26 Pln | |
| Fluorochem | 1g | 633.13 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
5-phenylpyrimidin-2-amine (CAS 31408-23-8) is a chemical compound with the molecular formula C10H9N3 and a molecular weight of 171.20 g/mol. IUPAC name: 5-phenylpyrimidin-2-amine. InChIKey: JYGOFGJNWGAPAN-UHFFFAOYSA-N.
| Molecular formula | C10H9N3 |
|---|---|
| Molecular weight | 171.20 g/mol |
| IUPAC name | 5-phenylpyrimidin-2-amine |
| InChIKey | JYGOFGJNWGAPAN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(N=C2)N |
Computed by PubChem (NCBI)