cas: 1638760-00-5 — see every product listed under this CAS number, including other names
5-bromo-6-fluoro-2,3-dimethyl-2H-indazole, 97% (CAS 1638760-00-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg. Offered by: AmBeed, Fluorochem, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A424601-1g |
| cas | 1638760-00-5 |
| size | 1g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 10752.91 Pln | |
| AmBeed | 5g | 32118.73 Pln | |
| Fluorochem | 100mg | 1060.06 Pln | |
| Fluorochem | 250mg | 2018.06 Pln | |
| Fluorochem | 500mg | 2991.67 Pln | |
| Fluorochem | 1g | 4881.63 Pln | |
| Chemat | 100mg | 635.60 Pln | |
| Chemat | 250mg | 1206.80 Pln | |
| Chemat | 500mg | 1782.80 Pln | |
| Chemat | 1g | 2925.20 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-bromo-6-fluoro-2,3-dimethylindazole (CAS 1638760-00-5) is a chemical compound with the molecular formula C9H8BrFN2 and a molecular weight of 243.08 g/mol. IUPAC name: 5-bromo-6-fluoro-2,3-dimethylindazole. InChIKey: QJMZJPTZUFZVAA-UHFFFAOYSA-N.
| Molecular formula | C9H8BrFN2 |
|---|---|
| Molecular weight | 243.08 g/mol |
| IUPAC name | 5-bromo-6-fluoro-2,3-dimethylindazole |
| InChIKey | QJMZJPTZUFZVAA-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C(C(=CC2=NN1C)F)Br |
Computed by PubChem (NCBI)