CAS 2916880-57-2 is the registry number for 7-Bromo-8-fluoro-1,3-dimethylpyrrolo[1,2-a]pyrazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-8-fluoro-1,3-dimethylpyrrolo[1,2-a]pyrazine (CAS 2916880-57-2) is a chemical compound with the molecular formula C9H8BrFN2 and a molecular weight of 243.08 g/mol. IUPAC name: 7-bromo-8-fluoro-1,3-dimethylpyrrolo[1,2-a]pyrazine. InChIKey: TUMPTADVUNQIKP-UHFFFAOYSA-N.
| Molecular formula | C9H8BrFN2 |
|---|---|
| Molecular weight | 243.08 g/mol |
| IUPAC name | 7-bromo-8-fluoro-1,3-dimethylpyrrolo[1,2-a]pyrazine |
| InChIKey | TUMPTADVUNQIKP-UHFFFAOYSA-N |
| SMILES | CC1=CN2C=C(C(=C2C(=N1)C)F)Br |
Computed by PubChem (NCBI)