Products 2929228-60-2
CAS 2929228-60-2 is the registry number for 6-Bromo-8-fluoro-2,7-dimethylimidazo[1,2-a]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-8-fluoro-2,7-dimethylimidazo[1,2-a]pyridine (CAS 2929228-60-2) is a chemical compound with the molecular formula C9H8BrFN2 and a molecular weight of 243.08 g/mol. IUPAC name: 6-bromo-8-fluoro-2,7-dimethylimidazo[1,2-a]pyridine. InChIKey: KQZJUSIEDIKRPR-UHFFFAOYSA-N.
| Molecular formula | C9H8BrFN2 |
|---|---|
| Molecular weight | 243.08 g/mol |
| IUPAC name | 6-bromo-8-fluoro-2,7-dimethylimidazo[1,2-a]pyridine |
| InChIKey | KQZJUSIEDIKRPR-UHFFFAOYSA-N |
| SMILES | CC1=CN2C=C(C(=C(C2=N1)F)C)Br |
Computed by PubChem (NCBI)