CAS 1638760-00-5 appears in our catalog under these names: 5-bromo-6-fluoro-2,3-dimethyl-2H-indazole, 97%, 5-bromo-6-fluoro-2,3-dimethyl-2H-indazole, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg.
5-bromo-6-fluoro-2,3-dimethylindazole (CAS 1638760-00-5) is a chemical compound with the molecular formula C9H8BrFN2 and a molecular weight of 243.08 g/mol. IUPAC name: 5-bromo-6-fluoro-2,3-dimethylindazole. InChIKey: QJMZJPTZUFZVAA-UHFFFAOYSA-N.
| Molecular formula | C9H8BrFN2 |
|---|---|
| Molecular weight | 243.08 g/mol |
| IUPAC name | 5-bromo-6-fluoro-2,3-dimethylindazole |
| InChIKey | QJMZJPTZUFZVAA-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C(C(=CC2=NN1C)F)Br |
Computed by PubChem (NCBI)