CAS 1820684-32-9 is the registry number for 7-Bromo-5-fluoro-1,2-dimethyl-1,3-benzodiazole, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
7-bromo-5-fluoro-1,2-dimethylbenzimidazole (CAS 1820684-32-9) is a chemical compound with the molecular formula C9H8BrFN2 and a molecular weight of 243.08 g/mol. IUPAC name: 7-bromo-5-fluoro-1,2-dimethylbenzimidazole. InChIKey: QHGFZYKKEKWZGQ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrFN2 |
|---|---|
| Molecular weight | 243.08 g/mol |
| IUPAC name | 7-bromo-5-fluoro-1,2-dimethylbenzimidazole |
| InChIKey | QHGFZYKKEKWZGQ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1C)C(=CC(=C2)F)Br |
Computed by PubChem (NCBI)