cas: 83573-62-0 — see every product listed under this CAS number, including other names
5-methyl-6-nitro-2,3-dihydro-1H-1,3-benzodiazol-2-one, 95% (CAS 83573-62-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F721465-100MG |
| cas | 83573-62-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1049.65 Pln | |
| Fluorochem | 250mg | 1788.97 Pln | |
| Fluorochem | 1g | 5214.85 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
5-methyl-6-nitro-1,3-dihydrobenzimidazol-2-one (CAS 83573-62-0) is a chemical compound with the molecular formula C8H7N3O3 and a molecular weight of 193.16 g/mol. IUPAC name: 5-methyl-6-nitro-1,3-dihydrobenzimidazol-2-one. InChIKey: IPZGIHJVJJXQIK-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O3 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 5-methyl-6-nitro-1,3-dihydrobenzimidazol-2-one |
| InChIKey | IPZGIHJVJJXQIK-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1[N+](=O)[O-])NC(=O)N2 |
Computed by PubChem (NCBI)