cas: 195193-10-3 — see every product listed under this CAS number, including other names
5-phenylthieno[2,3-d]pyrimidin-4-amine (CAS 195193-10-3) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 5 mg. Offered by: Chemat, MedChemExpress.
| brand | Chemat |
|---|---|
| catalog number | Ch12BDNF-1mg |
| cas | 195193-10-3 |
| size | 1mg |
| availability | 0.2g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 218.00 Pln | |
| Chemat | 5mg | 424.40 Pln | |
| Chemat | 10mg | 602.00 Pln | |
| Chemat | 25mg | 995.60 Pln | |
| Chemat | 50mg | 1466.00 Pln | |
| Chemat | 100mg | 2114.00 Pln | |
| Chemat | 200mg | 2982.80 Pln | |
| MedChemExpress | 5 mg | 830.53 Pln | |
| MedChemExpress | 50 mg | 2827.45 Pln | |
| MedChemExpress | 10 mg | 1174.19 Pln | |
| MedChemExpress | 25 mg | 1926.52 Pln | |
| MedChemExpress | 1 mg | 435.79 Pln |
| delivery time | 3 weeks |
|---|
5-phenylthieno[2,3-d]pyrimidin-4-amine (CAS 195193-10-3) is a chemical compound with the molecular formula C12H9N3S and a molecular weight of 227.29 g/mol. IUPAC name: 5-phenylthieno[2,3-d]pyrimidin-4-amine. InChIKey: QKUFEXGLTQADSA-UHFFFAOYSA-N.
| Molecular formula | C12H9N3S |
|---|---|
| Molecular weight | 227.29 g/mol |
| IUPAC name | 5-phenylthieno[2,3-d]pyrimidin-4-amine |
| InChIKey | QKUFEXGLTQADSA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC3=NC=NC(=C23)N |
Computed by PubChem (NCBI)