CAS 651042-73-8 appears in our catalog under these names: 4-(Isoquinolin-1-yl)-1,3-thiazol-2-amine, 95%, 4-(Isoquinolin-1-yl)-1,3-thiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 50mg, 0,5g.
4-isoquinolin-1-yl-1,3-thiazol-2-amine (CAS 651042-73-8) is a chemical compound with the molecular formula C12H9N3S and a molecular weight of 227.29 g/mol. IUPAC name: 4-isoquinolin-1-yl-1,3-thiazol-2-amine. InChIKey: YLNUDNTUPQXQBM-UHFFFAOYSA-N.
| Molecular formula | C12H9N3S |
|---|---|
| Molecular weight | 227.29 g/mol |
| IUPAC name | 4-isoquinolin-1-yl-1,3-thiazol-2-amine |
| InChIKey | YLNUDNTUPQXQBM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CN=C2C3=CSC(=N3)N |
Computed by PubChem (NCBI)