Products 933242-89-8
CAS 933242-89-8 is the registry number for 2-Phenylpyrazolo[1,5-a]pyrazine-4(5h)-thione, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-phenyl-5H-pyrazolo[1,5-a]pyrazine-4-thione (CAS 933242-89-8) is a chemical compound with the molecular formula C12H9N3S and a molecular weight of 227.29 g/mol. IUPAC name: 2-phenyl-5H-pyrazolo[1,5-a]pyrazine-4-thione. InChIKey: OGMSDCBTNPFKEW-UHFFFAOYSA-N.
| Molecular formula | C12H9N3S |
|---|---|
| Molecular weight | 227.29 g/mol |
| IUPAC name | 2-phenyl-5H-pyrazolo[1,5-a]pyrazine-4-thione |
| InChIKey | OGMSDCBTNPFKEW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN3C=CNC(=S)C3=C2 |
Computed by PubChem (NCBI)