CAS 195193-10-3 appears in our catalog under these names: 5-Phenylthieno(2,3-d)pyrimidin-4-amine, 98%, 5-phenylthieno(2,3-d)pyrimidin-4-amine/ 97%, 5-Phenylthieno(2,3-d)pyrimidin-4-amine, 5-phenylthieno[2,3-d]pyrimidin-4-amine. Offered by: AmBeed, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10g, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
5-phenylthieno[2,3-d]pyrimidin-4-amine (CAS 195193-10-3) is a chemical compound with the molecular formula C12H9N3S and a molecular weight of 227.29 g/mol. IUPAC name: 5-phenylthieno[2,3-d]pyrimidin-4-amine. InChIKey: QKUFEXGLTQADSA-UHFFFAOYSA-N.
| Molecular formula | C12H9N3S |
|---|---|
| Molecular weight | 227.29 g/mol |
| IUPAC name | 5-phenylthieno[2,3-d]pyrimidin-4-amine |
| InChIKey | QKUFEXGLTQADSA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC3=NC=NC(=C23)N |
Computed by PubChem (NCBI)