CAS 70086-06-5 is the registry number for 5-(Naphthalen-1-yl)-1,3,4-thiadiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-naphthalen-1-yl-1,3,4-thiadiazol-2-amine (CAS 70086-06-5) is a chemical compound with the molecular formula C12H9N3S and a molecular weight of 227.29 g/mol. IUPAC name: 5-naphthalen-1-yl-1,3,4-thiadiazol-2-amine. InChIKey: FIABVYFGQUPGTA-UHFFFAOYSA-N.
| Molecular formula | C12H9N3S |
|---|---|
| Molecular weight | 227.29 g/mol |
| IUPAC name | 5-naphthalen-1-yl-1,3,4-thiadiazol-2-amine |
| InChIKey | FIABVYFGQUPGTA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C3=NN=C(S3)N |
Computed by PubChem (NCBI)