5H-Benzo[b]carbazole, 99%
cas: 243-28-7 — see every product listed under this CAS number, including other names
5H-Benzo[b]carbazole, 99% (CAS 243-28-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1145HW-100mg |
| cas | 243-28-7 |
| size | 100mg |
| availability | 200g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 280.40 Pln | |
| Chemat | 1g | 477.20 Pln | |
| Chemat | 5g | 750.80 Pln | |
| Chemat | 10g | 1096.40 Pln | |
| Chemat | 25g | 1442.00 Pln | |
| Chemat | 50g | 2474.00 Pln | |
| Chemat | 100g | 3506.00 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
5H-benzo[b]carbazole (CAS 243-28-7) is a chemical compound with the molecular formula C16H11N and a molecular weight of 217.26 g/mol. IUPAC name: 5H-benzo[b]carbazole. InChIKey: ROEOVWIEALGNLM-UHFFFAOYSA-N.
| Molecular formula | C16H11N |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 5H-benzo[b]carbazole |
| InChIKey | ROEOVWIEALGNLM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)C4=CC=CC=C4N3 |
Computed by PubChem (NCBI)