5H-Benzofuro[3,2-c]carbazole, 99%
cas: 1199616-66-4 — see every product listed under this CAS number, including other names
5H-Benzofuro[3,2-c]carbazole, 99% (CAS 1199616-66-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111PWQ-250mg |
| cas | 1199616-66-4 |
| size | 250mg |
| availability | 286.48g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 194.00 Pln | |
| Chemat | 10g | 304.40 Pln | |
| Chemat | 25g | 650.00 Pln | |
| Chemat | 50g | 1221.20 Pln | |
| Chemat | 100g | 2334.80 Pln | |
| Chemat | 250g | 5229.20 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
5H-[1]benzofuro[3,2-c]carbazole (CAS 1199616-66-4) is a chemical compound with the molecular formula C18H11NO and a molecular weight of 257.3 g/mol. IUPAC name: 5H-[1]benzofuro[3,2-c]carbazole. InChIKey: XYZGAMBQUKTSIJ-UHFFFAOYSA-N.
| Molecular formula | C18H11NO |
|---|---|
| Molecular weight | 257.3 g/mol |
| IUPAC name | 5H-[1]benzofuro[3,2-c]carbazole |
| InChIKey | XYZGAMBQUKTSIJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C=CC4=C3OC5=CC=CC=C45 |
Computed by PubChem (NCBI)