6,7-Dibromonaphthalen-1-ol, 95%
cas: 117157-37-6 — see every product listed under this CAS number, including other names
6,7-Dibromonaphthalen-1-ol, 95% (CAS 117157-37-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A804216-250mg |
| cas | 117157-37-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1299.31 Pln | |
| Ambeed | 1g | 3374.12 Pln | |
| Chemat | 50mg | 491.60 Pln | |
| Chemat | 100mg | 794.00 Pln | |
| Chemat | 250mg | 1307.60 Pln | |
| Chemat | 1g | 3414.80 Pln | |
| BLDpharm | 50mg | 536.50 Pln | |
| BLDpharm | 100mg | 847.50 Pln | |
| BLDpharm | 250mg | 1391.76 Pln | |
| BLDpharm | 1g | 3629.86 Pln | |
| Fluorochem | 50mg | 898.66 Pln | |
| Fluorochem | 100mg | 1466.17 Pln | |
| Fluorochem | 250mg | 2429.37 Pln | |
| Fluorochem | 1g | 6334.25 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
6,7-dibromonaphthalen-1-ol (CAS 117157-37-6) is a chemical compound with the molecular formula C10H6Br2O and a molecular weight of 301.96 g/mol. IUPAC name: 6,7-dibromonaphthalen-1-ol. InChIKey: DDYDWJNNWZCZRR-UHFFFAOYSA-N.
| Molecular formula | C10H6Br2O |
|---|---|
| Molecular weight | 301.96 g/mol |
| IUPAC name | 6,7-dibromonaphthalen-1-ol |
| InChIKey | DDYDWJNNWZCZRR-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C(C=C2C(=C1)O)Br)Br |
Computed by PubChem (NCBI)