CAS 2648221-50-3 is the registry number for 4,5-Dibromonaphthalen-2-ol, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg.
4,5-dibromonaphthalen-2-ol (CAS 2648221-50-3) is a chemical compound with the molecular formula C10H6Br2O and a molecular weight of 301.96 g/mol. IUPAC name: 4,5-dibromonaphthalen-2-ol. InChIKey: LPBXSBYKNRGQHF-UHFFFAOYSA-N.
| Molecular formula | C10H6Br2O |
|---|---|
| Molecular weight | 301.96 g/mol |
| IUPAC name | 4,5-dibromonaphthalen-2-ol |
| InChIKey | LPBXSBYKNRGQHF-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC(=C2C(=C1)Br)Br)O |
Computed by PubChem (NCBI)