cas: 1283075-60-4 — see every product listed under this CAS number, including other names
6,8-Dichloropyrido[2,3-b]pyrazine 97% (CAS 1283075-60-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A272294-100mg |
| cas | 1283075-60-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 987.81 Pln | |
| Ambeed | 250mg | 1621.94 Pln | |
| Ambeed | 1g | 4241.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A272294 |
6,8-dichloropyrido[2,3-b]pyrazine (CAS 1283075-60-4) is a chemical compound with the molecular formula C7H3Cl2N3 and a molecular weight of 200.02 g/mol. IUPAC name: 6,8-dichloropyrido[2,3-b]pyrazine. InChIKey: BIULHHKFNLFURG-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2N3 |
|---|---|
| Molecular weight | 200.02 g/mol |
| IUPAC name | 6,8-dichloropyrido[2,3-b]pyrazine |
| InChIKey | BIULHHKFNLFURG-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=N1)C(=CC(=N2)Cl)Cl |
Computed by PubChem (NCBI)