cas: 929339-40-2 — see every product listed under this CAS number, including other names
6,8-Dichloroquinolin-4-amine, 97%, 97% (CAS 929339-40-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GUSM-100mg |
| cas | 929339-40-2 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 294.80 Pln | |
| Chemat | 250mg | 525.20 Pln | |
| Chemat | 1g | 1360.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6,8-dichloroquinolin-4-amine (CAS 929339-40-2) is a chemical compound with the molecular formula C9H6Cl2N2 and a molecular weight of 213.06 g/mol. IUPAC name: 6,8-dichloroquinolin-4-amine. InChIKey: LWGSDQPVVLEBKP-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2 |
|---|---|
| Molecular weight | 213.06 g/mol |
| IUPAC name | 6,8-dichloroquinolin-4-amine |
| InChIKey | LWGSDQPVVLEBKP-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=CC(=CC2=C1N)Cl)Cl |
Computed by PubChem (NCBI)