cas: 4887-91-6 — see every product listed under this CAS number, including other names
6–Chloro–2–propyl–1H–benzo(d)imidazole (CAS 4887-91-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 50mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD07787-1g |
| cas | 4887-91-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 882.55 Pln | |
| GLPBio | 250mg | 601.72 Pln | |
| GLPBio | 50mg | 559.60 Pln | |
| GLPBio | 5g | 2057.36 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
6-chloro-2-propyl-1H-benzimidazole (CAS 4887-91-6) is a chemical compound with the molecular formula C10H11ClN2 and a molecular weight of 194.66 g/mol. IUPAC name: 6-chloro-2-propyl-1H-benzimidazole. InChIKey: OIIZPYFXIHFYQR-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2 |
|---|---|
| Molecular weight | 194.66 g/mol |
| IUPAC name | 6-chloro-2-propyl-1H-benzimidazole |
| InChIKey | OIIZPYFXIHFYQR-UHFFFAOYSA-N |
| SMILES | CCCC1=NC2=C(N1)C=C(C=C2)Cl |
Computed by PubChem (NCBI)