cas: 4887-91-6 — see every product listed under this CAS number, including other names
6-Chloro-2-propyl-1H-benzo[d]imidazole, 98%, 98% (CAS 4887-91-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DBKJ-50mg |
| cas | 4887-91-6 |
| size | 50mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 150.80 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 429.20 Pln | |
| Chemat | 5g | 1427.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-chloro-2-propyl-1H-benzimidazole (CAS 4887-91-6) is a chemical compound with the molecular formula C10H11ClN2 and a molecular weight of 194.66 g/mol. IUPAC name: 6-chloro-2-propyl-1H-benzimidazole. InChIKey: OIIZPYFXIHFYQR-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2 |
|---|---|
| Molecular weight | 194.66 g/mol |
| IUPAC name | 6-chloro-2-propyl-1H-benzimidazole |
| InChIKey | OIIZPYFXIHFYQR-UHFFFAOYSA-N |
| SMILES | CCCC1=NC2=C(N1)C=C(C=C2)Cl |
Computed by PubChem (NCBI)