cas: 1628317-84-9 — see every product listed under this CAS number, including other names
6-(2,2,2-TRIFLUOROETHYL)THIENO[2,3-D]PYRIMIDIN-4(3H)-ONE, 98% (CAS 1628317-84-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F530274-50MG |
| cas | 1628317-84-9 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 737.26 Pln | |
| Fluorochem | 100mg | 1221.46 Pln | |
| Fluorochem | 250mg | 2377.31 Pln | |
| Fluorochem | 1g | 5162.78 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
6-(2,2,2-trifluoroethyl)-3H-thieno[2,3-d]pyrimidin-4-one (CAS 1628317-84-9) is a chemical compound with the molecular formula C8H5F3N2OS and a molecular weight of 234.20 g/mol. IUPAC name: 6-(2,2,2-trifluoroethyl)-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: MPAWLCWXJREENO-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2OS |
|---|---|
| Molecular weight | 234.20 g/mol |
| IUPAC name | 6-(2,2,2-trifluoroethyl)-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | MPAWLCWXJREENO-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=C1C(=O)NC=N2)CC(F)(F)F |
Computed by PubChem (NCBI)