cas: 1628317-84-9 — see every product listed under this CAS number, including other names
6-(2,2,2-Trifluoroethyl)thieno[2,3-d]pyrimidin-4(1H)-one, 98%, 98% (CAS 1628317-84-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DKJ4-100mg |
| cas | 1628317-84-9 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 933.20 Pln | |
| Chemat | 250mg | 1806.80 Pln | |
| Chemat | 1g | 4427.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-(2,2,2-trifluoroethyl)-3H-thieno[2,3-d]pyrimidin-4-one (CAS 1628317-84-9) is a chemical compound with the molecular formula C8H5F3N2OS and a molecular weight of 234.20 g/mol. IUPAC name: 6-(2,2,2-trifluoroethyl)-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: MPAWLCWXJREENO-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2OS |
|---|---|
| Molecular weight | 234.20 g/mol |
| IUPAC name | 6-(2,2,2-trifluoroethyl)-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | MPAWLCWXJREENO-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=C1C(=O)NC=N2)CC(F)(F)F |
Computed by PubChem (NCBI)