cas: 1188539-34-5 — see every product listed under this CAS number, including other names
6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)furo[3,2-b]pyridine, 97% (CAS 1188539-34-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F691601-100MG |
| cas | 1188539-34-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 2044.09 Pln | |
| Fluorochem | 250mg | 3225.97 Pln | |
| Fluorochem | 500mg | 5324.18 Pln | |
| Fluorochem | 1g | 7943.05 Pln | |
| Fluorochem | 5g | 23687.51 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furo[3,2-b]pyridine (CAS 1188539-34-5) is a chemical compound with the molecular formula C13H16BNO3 and a molecular weight of 245.08 g/mol. IUPAC name: 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furo[3,2-b]pyridine. InChIKey: GSSJAXUDJLCMNO-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO3 |
|---|---|
| Molecular weight | 245.08 g/mol |
| IUPAC name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furo[3,2-b]pyridine |
| InChIKey | GSSJAXUDJLCMNO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=CO3)N=C2 |
Computed by PubChem (NCBI)