cas: 1219130-56-9 — see every product listed under this CAS number, including other names
6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinolin-1(2H)-one, 97% (CAS 1219130-56-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F332091-250MG |
| cas | 1219130-56-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 1g | 883.04 Pln | |
| Fluorochem | 5g | 3080.18 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-isoquinolin-1-one (CAS 1219130-56-9) is a chemical compound with the molecular formula C15H18BNO3 and a molecular weight of 271.12 g/mol. IUPAC name: 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-isoquinolin-1-one. InChIKey: ZGNSYBSEZVIFNK-UHFFFAOYSA-N.
| Molecular formula | C15H18BNO3 |
|---|---|
| Molecular weight | 271.12 g/mol |
| IUPAC name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-isoquinolin-1-one |
| InChIKey | ZGNSYBSEZVIFNK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C(=O)NC=C3 |
Computed by PubChem (NCBI)