cas: 675576-26-8 — see every product listed under this CAS number, including other names
6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline, 97%, 97% (CAS 675576-26-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117EUE-50mg |
| cas | 675576-26-8 |
| size | 50mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 155.60 Pln | |
| Chemat | 100mg | 218.00 Pln | |
| Chemat | 10g | 3942.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline (CAS 675576-26-8) is a chemical compound with the molecular formula C15H18BNO2 and a molecular weight of 255.12 g/mol. IUPAC name: 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline. InChIKey: LFALMDZWCMSBFO-UHFFFAOYSA-N.
| Molecular formula | C15H18BNO2 |
|---|---|
| Molecular weight | 255.12 g/mol |
| IUPAC name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline |
| InChIKey | LFALMDZWCMSBFO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C=NC=C3 |
Computed by PubChem (NCBI)