6-(4-Chlorophenyl)imidazo[2,1-b]thiazole, 90%
cas: 7025-30-1 — see every product listed under this CAS number, including other names
6-(4-Chlorophenyl)imidazo[2,1-b]thiazole, 90% (CAS 7025-30-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A906135-250mg |
| cas | 7025-30-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 804.25 Pln | |
| Ambeed | 5g | 2495.25 Pln | |
| BLDpharm | 250mg | 369.89 Pln | |
| BLDpharm | 1g | 858.61 Pln | |
| BLDpharm | 5g | 2669.08 Pln | |
| Chemat | 100mg | 194.00 Pln | |
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 1g | 678.80 Pln | |
| Chemat | 5g | 2094.80 Pln | |
| Fluorochem | 1g | 825.77 Pln | |
| Fluorochem | 5g | 2569.95 Pln |
properties
| purity | 90% |
|---|---|
| delivery time | 2-3 weeks |
6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazole (CAS 7025-30-1) is a chemical compound with the molecular formula C11H7ClN2S and a molecular weight of 234.71 g/mol. IUPAC name: 6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazole. InChIKey: TTXYDMVOVAJTCI-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN2S |
|---|---|
| Molecular weight | 234.71 g/mol |
| IUPAC name | 6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazole |
| InChIKey | TTXYDMVOVAJTCI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN3C=CSC3=N2)Cl |
Computed by PubChem (NCBI)
Synonyms:
6-(4-chlorophenyl)imidazo[2,1-b]thiazole, 6-(4-Chlorophenyl)imidazo(2,1-b)thiazole, 6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazole, Imidazo[2,1-b]thiazole, 6-(4-chlorophenyl)-, 6-(4-chlorophenyl)imidazo[2,1-b]1,3-thiazoline, Selectivin-A, Bionet2_000092, Cambridge id 5121613, TTXYDMVOVAJTCI-UHFFFAOYSA-N, 6-(4-Chlorophenyl)imidazo[2,1-b]thiazole, 97%