CAS 86604-36-6 is the registry number for 2–Amino–4–(4–chlorophenyl)thiophene–3–carbonitrile. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
2-amino-4-(4-chlorophenyl)thiophene-3-carbonitrile (CAS 86604-36-6) is a chemical compound with the molecular formula C11H7ClN2S and a molecular weight of 234.71 g/mol. IUPAC name: 2-amino-4-(4-chlorophenyl)thiophene-3-carbonitrile. InChIKey: DENZDRMQVPFLLB-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN2S |
|---|---|
| Molecular weight | 234.71 g/mol |
| IUPAC name | 2-amino-4-(4-chlorophenyl)thiophene-3-carbonitrile |
| InChIKey | DENZDRMQVPFLLB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC(=C2C#N)N)Cl |
Computed by PubChem (NCBI)