CAS 7025-30-1 appears in our catalog under these names: 6-(4-Chlorophenyl)imidazo(2,1-b)thiazole, 6-(4-Chlorophenyl)imidazo[2,1-b]thiazole 90%, 6-(4-Chlorophenyl)imidazo[2,1-b]thiazole, 90%, 90%, 6-(4-Chlorophenyl)imidazo[2,1-b]thiazole, 90%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 50mg, 1g, 5g.
6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazole (CAS 7025-30-1) is a chemical compound with the molecular formula C11H7ClN2S and a molecular weight of 234.71 g/mol. IUPAC name: 6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazole. InChIKey: TTXYDMVOVAJTCI-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN2S |
|---|---|
| Molecular weight | 234.71 g/mol |
| IUPAC name | 6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazole |
| InChIKey | TTXYDMVOVAJTCI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN3C=CSC3=N2)Cl |
Computed by PubChem (NCBI)