CAS 18832-93-4 is the registry number for 2-(2-(4-Chlorophenyl)-1,3-thiazol-4-yl)acetonitrile. Offered by: TRC. Available pack sizes: 1g.
2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]acetonitrile (CAS 18832-93-4) is a chemical compound with the molecular formula C11H7ClN2S and a molecular weight of 234.71 g/mol. IUPAC name: 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]acetonitrile. InChIKey: VATBLIZQMIUHJM-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN2S |
|---|---|
| Molecular weight | 234.71 g/mol |
| IUPAC name | 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]acetonitrile |
| InChIKey | VATBLIZQMIUHJM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CS2)CC#N)Cl |
Computed by PubChem (NCBI)