CAS 17969-48-1 is the registry number for 2-[4-(4-Chlorophenyl)-1,3-thiazol-2-yl]acetonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g, 250mg.
2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]acetonitrile (CAS 17969-48-1) is a chemical compound with the molecular formula C11H7ClN2S and a molecular weight of 234.71 g/mol. IUPAC name: 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]acetonitrile. InChIKey: CECOBIWITUICNO-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN2S |
|---|---|
| Molecular weight | 234.71 g/mol |
| IUPAC name | 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]acetonitrile |
| InChIKey | CECOBIWITUICNO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC(=N2)CC#N)Cl |
Computed by PubChem (NCBI)