6-(Benzyloxy)-6-oxohexanoic acid, 97%, 97%
cas: 40542-90-3 — see every product listed under this CAS number, including other names
6-(Benzyloxy)-6-oxohexanoic acid, 97%, 97% (CAS 40542-90-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1187MD-250mg |
| cas | 40542-90-3 |
| size | 250mg |
| availability | 1000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 270.80 Pln | |
| Chemat | 25g | 774.80 Pln | |
| Chemat | 100g | 2421.20 Pln | |
| Chemat | 500g | 9561.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-oxo-6-phenylmethoxyhexanoic acid (CAS 40542-90-3) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: 6-oxo-6-phenylmethoxyhexanoic acid. InChIKey: CQSWISNVQPOAEM-UHFFFAOYSA-N.
| Molecular formula | C13H16O4 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | 6-oxo-6-phenylmethoxyhexanoic acid |
| InChIKey | CQSWISNVQPOAEM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CCCCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
ADIPIC ACID MONOBENZYL ESTER, 6-(benzyloxy)-6-oxohexanoic acid, monobenzyl adipate, 6-oxo-6-phenylmethoxyhexanoic acid, Hexanedioic acid,1-(phenylmethyl) ester, 5-(Benzyloxycarbonyl)pentanoic acid, 6(benzyloxy)-6-oxohexanoic acid, Hexanedioic Acid Monobenzyl Ester, CQSWISNVQPOAEM-UHFFFAOYSA-N, Adipic acid monobenzyl ester>/= 99% (HPLC)