cas: 162752-17-2 — see every product listed under this CAS number, including other names
6-(tert-Butyl)-2,3-dihydro-1H-inden-1-one 95% (CAS 162752-17-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A190075-100mg |
| cas | 162752-17-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 170.12 Pln | |
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 665.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A190075 |
6-tert-butyl-2,3-dihydroinden-1-one (CAS 162752-17-2) is a chemical compound with the molecular formula C13H16O and a molecular weight of 188.26 g/mol. IUPAC name: 6-tert-butyl-2,3-dihydroinden-1-one. InChIKey: VICFYSNYODVXCU-UHFFFAOYSA-N.
| Molecular formula | C13H16O |
|---|---|
| Molecular weight | 188.26 g/mol |
| IUPAC name | 6-tert-butyl-2,3-dihydroinden-1-one |
| InChIKey | VICFYSNYODVXCU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(CCC2=O)C=C1 |
Computed by PubChem (NCBI)