cas: 162752-17-2 — see every product listed under this CAS number, including other names
6-(tert-Butyl)-2,3-dihydro-1H-inden-1-one, 97%, 97% (CAS 162752-17-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112TEE-100mg |
| cas | 162752-17-2 |
| size | 100mg |
| availability | 27.67g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 544.40 Pln | |
| Chemat | 25g | 2435.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-tert-butyl-2,3-dihydroinden-1-one (CAS 162752-17-2) is a chemical compound with the molecular formula C13H16O and a molecular weight of 188.26 g/mol. IUPAC name: 6-tert-butyl-2,3-dihydroinden-1-one. InChIKey: VICFYSNYODVXCU-UHFFFAOYSA-N.
| Molecular formula | C13H16O |
|---|---|
| Molecular weight | 188.26 g/mol |
| IUPAC name | 6-tert-butyl-2,3-dihydroinden-1-one |
| InChIKey | VICFYSNYODVXCU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(CCC2=O)C=C1 |
Computed by PubChem (NCBI)