6-(tert-Butylamino)nicotinic acid, 98%
cas: 1019387-69-9 — see every product listed under this CAS number, including other names
6-(tert-Butylamino)nicotinic acid, 98% (CAS 1019387-69-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1385186-1g |
| cas | 1019387-69-9 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 337.00 Pln | |
| Ambeed | 5g | 926.62 Pln | |
| Ambeed | 25g | 3051.50 Pln | |
| Ambeed | 100g | 9815.50 Pln | |
| Chemat | 1g | 237.20 Pln | |
| Chemat | 5g | 669.20 Pln | |
| Chemat | 25g | 2186.00 Pln | |
| Chemat | 100g | 7067.60 Pln | |
| BLDpharm | 1g | 331.02 Pln | |
| BLDpharm | 5g | 914.15 Pln | |
| BLDpharm | 25g | 2991.19 Pln | |
| BLDpharm | 100g | 9627.75 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
6-(tert-butylamino)pyridine-3-carboxylic acid (CAS 1019387-69-9) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: 6-(tert-butylamino)pyridine-3-carboxylic acid. InChIKey: ZJWDUXSEAHEJED-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 6-(tert-butylamino)pyridine-3-carboxylic acid |
| InChIKey | ZJWDUXSEAHEJED-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC1=NC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)