Products 1019387-69-9
CAS 1019387-69-9 appears in our catalog under these names: 6-(tert-Butylamino)nicotinic acid, 98%, 98%, 6-(tert-Butylamino)nicotinic acid, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 1g, 5g, 25g, 100g.
6-(tert-butylamino)pyridine-3-carboxylic acid (CAS 1019387-69-9) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: 6-(tert-butylamino)pyridine-3-carboxylic acid. InChIKey: ZJWDUXSEAHEJED-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 6-(tert-butylamino)pyridine-3-carboxylic acid |
| InChIKey | ZJWDUXSEAHEJED-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC1=NC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)