cas: 17295-26-0 — see every product listed under this CAS number, including other names
6-Acetoxy-2-naphthoic Acid, 98%, 98% (CAS 17295-26-0) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114N2T-200mg |
| cas | 17295-26-0 |
| size | 200mg |
| availability | 150g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 200mg | 136.40 Pln | |
| Chemat | 1g | 261.20 Pln | |
| Chemat | 5g | 654.80 Pln | |
| Chemat | 25g | 2603.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-acetyloxynaphthalene-2-carboxylic acid (CAS 17295-26-0) is a chemical compound with the molecular formula C13H10O4 and a molecular weight of 230.22 g/mol. IUPAC name: 6-acetyloxynaphthalene-2-carboxylic acid. InChIKey: NFTLBCXRDNIJMI-UHFFFAOYSA-N.
| Molecular formula | C13H10O4 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | 6-acetyloxynaphthalene-2-carboxylic acid |
| InChIKey | NFTLBCXRDNIJMI-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC2=C(C=C1)C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)