CAS 874782-54-4 appears in our catalog under these names: 6–Amino–3–chloro–2–fluorobenzoic acid, 6-Amino-3-chloro-2-fluorobenzoic acid, 97%, 97%, 6-Amino-3-chloro-2-fluorobenzoic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
6-amino-3-chloro-2-fluorobenzoic acid (CAS 874782-54-4) is a chemical compound with the molecular formula C7H5ClFNO2 and a molecular weight of 189.57 g/mol. IUPAC name: 6-amino-3-chloro-2-fluorobenzoic acid. InChIKey: UTSMLAOLXKYKDS-UHFFFAOYSA-N.
| Molecular formula | C7H5ClFNO2 |
|---|---|
| Molecular weight | 189.57 g/mol |
| IUPAC name | 6-amino-3-chloro-2-fluorobenzoic acid |
| InChIKey | UTSMLAOLXKYKDS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N)C(=O)O)F)Cl |
Computed by PubChem (NCBI)