cas: 99071-54-2 — see every product listed under this CAS number, including other names
6-Aminomethylquinoline 95% (CAS 99071-54-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A241150-100mg |
| cas | 99071-54-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 186.81 Pln | |
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 370.38 Pln | |
| Ambeed | 5g | 1221.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A241150 |
Quinolin-6-ylmethanamine (CAS 99071-54-2) is a chemical compound with the molecular formula C10H10N2 and a molecular weight of 158.20 g/mol. IUPAC name: quinolin-6-ylmethanamine. InChIKey: RZIPENSSTUBRAA-UHFFFAOYSA-N.
| Molecular formula | C10H10N2 |
|---|---|
| Molecular weight | 158.20 g/mol |
| IUPAC name | quinolin-6-ylmethanamine |
| InChIKey | RZIPENSSTUBRAA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)CN)N=C1 |
Computed by PubChem (NCBI)