cas: 52113-69-6 — see every product listed under this CAS number, including other names
6-BROMO-2,2-DIMETHYL-4H-BENZO[D][1,3]DIOXINE, 95% (CAS 52113-69-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F529089-250MG |
| cas | 52113-69-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 924.69 Pln | |
| Fluorochem | 1g | 1752.53 Pln | |
| Fluorochem | 5g | 4569.24 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
6-bromo-2,2-dimethyl-4H-1,3-benzodioxine (CAS 52113-69-6) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: 6-bromo-2,2-dimethyl-4H-1,3-benzodioxine. InChIKey: UIALGZOSKLCMHF-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | 6-bromo-2,2-dimethyl-4H-1,3-benzodioxine |
| InChIKey | UIALGZOSKLCMHF-UHFFFAOYSA-N |
| SMILES | CC1(OCC2=C(O1)C=CC(=C2)Br)C |
Computed by PubChem (NCBI)