cas: 52113-69-6 — see every product listed under this CAS number, including other names
6-Bromo-2,2-dimethyl-2,4-dihydro-1,3-benzodioxine, 99%, 99% (CAS 52113-69-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DK81-100mg |
| cas | 52113-69-6 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 410.00 Pln | |
| Chemat | 250mg | 578.00 Pln | |
| Chemat | 1g | 1072.40 Pln | |
| Chemat | 5g | 2776.40 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
6-bromo-2,2-dimethyl-4H-1,3-benzodioxine (CAS 52113-69-6) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: 6-bromo-2,2-dimethyl-4H-1,3-benzodioxine. InChIKey: UIALGZOSKLCMHF-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | 6-bromo-2,2-dimethyl-4H-1,3-benzodioxine |
| InChIKey | UIALGZOSKLCMHF-UHFFFAOYSA-N |
| SMILES | CC1(OCC2=C(O1)C=CC(=C2)Br)C |
Computed by PubChem (NCBI)