cas: 635698-34-9 — see every product listed under this CAS number, including other names
6-Benzyl-6,7-dihydro-1H-pyrrolo[3,4-d]pyrimidine-2,4(3H,5H)-dione 97% (CAS 635698-34-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A386469-100mg |
| cas | 635698-34-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 448.25 Pln | |
| Ambeed | 250mg | 609.56 Pln | |
| Ambeed | 1g | 1766.56 Pln | |
| Ambeed | 5g | 3791.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A386469 |
6-benzyl-5,7-dihydro-1H-pyrrolo[3,4-d]pyrimidine-2,4-dione (CAS 635698-34-9) is a chemical compound with the molecular formula C13H13N3O2 and a molecular weight of 243.26 g/mol. IUPAC name: 6-benzyl-5,7-dihydro-1H-pyrrolo[3,4-d]pyrimidine-2,4-dione. InChIKey: HHPFBTNJYIYLKC-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O2 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | 6-benzyl-5,7-dihydro-1H-pyrrolo[3,4-d]pyrimidine-2,4-dione |
| InChIKey | HHPFBTNJYIYLKC-UHFFFAOYSA-N |
| SMILES | C1C2=C(CN1CC3=CC=CC=C3)NC(=O)NC2=O |
Computed by PubChem (NCBI)