cas: 635698-34-9 — see every product listed under this CAS number, including other names
6-Benzyl-6,7-dihydro-1H-pyrrolo[3,4-d]pyrimidine-2,4(3H,5H)-dione, 97%, 97% (CAS 635698-34-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E0P5-100mg |
| cas | 635698-34-9 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 376.40 Pln | |
| Chemat | 250mg | 467.60 Pln | |
| Chemat | 1g | 1187.60 Pln | |
| Chemat | 5g | 2670.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-benzyl-5,7-dihydro-1H-pyrrolo[3,4-d]pyrimidine-2,4-dione (CAS 635698-34-9) is a chemical compound with the molecular formula C13H13N3O2 and a molecular weight of 243.26 g/mol. IUPAC name: 6-benzyl-5,7-dihydro-1H-pyrrolo[3,4-d]pyrimidine-2,4-dione. InChIKey: HHPFBTNJYIYLKC-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O2 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | 6-benzyl-5,7-dihydro-1H-pyrrolo[3,4-d]pyrimidine-2,4-dione |
| InChIKey | HHPFBTNJYIYLKC-UHFFFAOYSA-N |
| SMILES | C1C2=C(CN1CC3=CC=CC=C3)NC(=O)NC2=O |
Computed by PubChem (NCBI)