cas: 130420-78-9 — see every product listed under this CAS number, including other names
6-BroMo-5-Methoxyindoline-2,3-dione, 95%, 95% (CAS 130420-78-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111UEZ-100mg |
| cas | 130420-78-9 |
| size | 100mg |
| availability | 0.45g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 405.20 Pln | |
| Chemat | 250mg | 611.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-bromo-5-methoxy-1H-indole-2,3-dione (CAS 130420-78-9) is a chemical compound with the molecular formula C9H6BrNO3 and a molecular weight of 256.05 g/mol. IUPAC name: 6-bromo-5-methoxy-1H-indole-2,3-dione. InChIKey: YAPKYMNANRNKHH-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO3 |
|---|---|
| Molecular weight | 256.05 g/mol |
| IUPAC name | 6-bromo-5-methoxy-1H-indole-2,3-dione |
| InChIKey | YAPKYMNANRNKHH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=O)C(=O)N2)Br |
Computed by PubChem (NCBI)