CAS 258508-82-6 is the registry number for 6-Bromo-5-methyl-1h-benzo[d][1,3]oxazine-2,4-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-bromo-5-methyl-1H-3,1-benzoxazine-2,4-dione (CAS 258508-82-6) is a chemical compound with the molecular formula C9H6BrNO3 and a molecular weight of 256.05 g/mol. IUPAC name: 6-bromo-5-methyl-1H-3,1-benzoxazine-2,4-dione. InChIKey: ZAPSCUJQCONCQG-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO3 |
|---|---|
| Molecular weight | 256.05 g/mol |
| IUPAC name | 6-bromo-5-methyl-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | ZAPSCUJQCONCQG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1C(=O)OC(=O)N2)Br |
Computed by PubChem (NCBI)