Products 130420-78-9
CAS 130420-78-9 appears in our catalog under these names: 6-Bromo-5-methoxyindoline-2,3-dione, 95%, 6–BroMo–5–Methoxyindoline–2，3–dione, 6-Bromo-5-methoxyindoline-2,3-dione, 6-BroMo-5-Methoxyindoline-2，3-dione, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 50mg, 0,5g.
6-bromo-5-methoxy-1H-indole-2,3-dione (CAS 130420-78-9) is a chemical compound with the molecular formula C9H6BrNO3 and a molecular weight of 256.05 g/mol. IUPAC name: 6-bromo-5-methoxy-1H-indole-2,3-dione. InChIKey: YAPKYMNANRNKHH-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO3 |
|---|---|
| Molecular weight | 256.05 g/mol |
| IUPAC name | 6-bromo-5-methoxy-1H-indole-2,3-dione |
| InChIKey | YAPKYMNANRNKHH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=O)C(=O)N2)Br |
Computed by PubChem (NCBI)