CAS 177970-27-3 appears in our catalog under these names: 8-Bromo-6-methyl-1h-benzo[d][1,3]oxazine-2,4-dione, 95%, 8-Bromo-6-methyl-1H-benzo(d)(1,3)oxazine-2,4-dione, 95+%, 8-Bromo-6-methyl-1H-benzo(d)(1,3)oxazine-2,4-dione. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
8-bromo-6-methyl-1H-3,1-benzoxazine-2,4-dione (CAS 177970-27-3) is a chemical compound with the molecular formula C9H6BrNO3 and a molecular weight of 256.05 g/mol. IUPAC name: 8-bromo-6-methyl-1H-3,1-benzoxazine-2,4-dione. InChIKey: XDPLOGJWYJBJGE-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO3 |
|---|---|
| Molecular weight | 256.05 g/mol |
| IUPAC name | 8-bromo-6-methyl-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | XDPLOGJWYJBJGE-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1)Br)NC(=O)OC2=O |
Computed by PubChem (NCBI)