cas: 72754-05-3 — see every product listed under this CAS number, including other names
6-Bromo-[1,8]naphthyridin-2(1H)-one, 95% (CAS 72754-05-3) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | MAY00219DA |
| cas | 72754-05-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 1g | 865.44 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 95% |
6-bromo-1H-1,8-naphthyridin-2-one (CAS 72754-05-3) is a chemical compound with the molecular formula C8H5BrN2O and a molecular weight of 225.04 g/mol. IUPAC name: 6-bromo-1H-1,8-naphthyridin-2-one. InChIKey: BCEWGGGNOQNYKK-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O |
|---|---|
| Molecular weight | 225.04 g/mol |
| IUPAC name | 6-bromo-1H-1,8-naphthyridin-2-one |
| InChIKey | BCEWGGGNOQNYKK-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NC2=NC=C(C=C21)Br |
Computed by PubChem (NCBI)