cas: 72754-05-3 — see every product listed under this CAS number, including other names
6-Bromo-1,8-naphthyridin-2-ol, 95%, 95% (CAS 72754-05-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114N4F-100mg |
| cas | 72754-05-3 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 189.20 Pln | |
| Chemat | 5g | 712.40 Pln | |
| Chemat | 10g | 1240.40 Pln | |
| Chemat | 25g | 3016.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-bromo-1H-1,8-naphthyridin-2-one (CAS 72754-05-3) is a chemical compound with the molecular formula C8H5BrN2O and a molecular weight of 225.04 g/mol. IUPAC name: 6-bromo-1H-1,8-naphthyridin-2-one. InChIKey: BCEWGGGNOQNYKK-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O |
|---|---|
| Molecular weight | 225.04 g/mol |
| IUPAC name | 6-bromo-1H-1,8-naphthyridin-2-one |
| InChIKey | BCEWGGGNOQNYKK-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NC2=NC=C(C=C21)Br |
Computed by PubChem (NCBI)